Bundesrecht konsolidiert

Außenhandelsgesetz 2005 Anl. 1

Diese Fassung ist nicht aktuell

Kurztitel

Außenhandelsgesetz 2005Nächster Suchbegriff

Kundmachungsorgan

BGBl. I Nr. 50/2005 aufgehoben durch BGBl. I Nr. 26/2011

Typ

BG

§/Artikel/Anlage

Anl. 1

Inkrafttretensdatum

01.10.2005

Außerkrafttretensdatum

30.09.2011

Abkürzung

Vorheriger SuchbegriffAußHG 2005

Index

54/02 Außenhandelsgesetz

Text

Anhang

CHEMIKALIENLISTEN

In den folgenden Listen sind toxische Chemikalien und Vorprodukte und für die Anwendung der CWK kritische Chemikalien genannt. Zum Zweck der Durchführung dieses Übereinkommens sind in den Listen die Chemikalien angegeben, auf welche die im Verifikationsanhang der CWK vorgesehenen Verifikationsmaßnahmen anzuwenden sind.

(Jeder Hinweis auf Gruppen dialkylierter Chemikalien denen - in Klammern - eine Aufzählung von Alkylgruppen folgt, bedeutet, dass alle Verbindungen, die sich durch sämtliche mögliche Kombinationen der in Klammern genannten Alkylgruppen ergeben, als in die entsprechende Liste eingetragen gelten, sofern sie nicht ausdrücklich ausgenommen sind.)

Registriernummer nach

Chemical Abstracts Service

(CAS-Nummer)

Liste 1

A. Toxische Chemikalien:

 

1.

O-Alkyl (C10, einschließlich Cycloalkyl)-alkyl-(Me, Et, n-Pr oder
i-Pr)phosphonofluoride

 

zB Sarin: O-Isopropylmethylphosphonofluorid

(107-44-8)

 Soman: O-Pinakolylmethylphosphonofluorid

(96-64-0)

2.

O-Alkyl (C10 einschließlich Cycloalkyl)-N,N-dialkyl (Me, Et, n-Pr oder i-Pr)-phosphoramidocyanide

 

zB Tabun: O-Ethyl-N,N-dimethylphosphoramidocyanid

(77-81-6)

3.

O-Alkyl (H oder C10 einschließlich Cycloalkyl)- S-2-dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethylalkyl (Me, Et, n-Pr oder i-Pr)-phosphonothiolate sowie entsprechende alkylierte und protonierte Salze

 

zB VX: O-Ethyl-S-2-diisopropylaminoethylmethyl-phosphonothiolat

(50782-69-9)

4.

Schwefelloste:

 

2-Chlorethylchlormethylsulfid

(2625-76-5)

Senfgas: Bis- (2-chlorethyl)-sulfid

(505-60-2)

Bis-(2-chlorethylthio)-methan

(63869-13-6)

Sesqui-Yperit (Q): 1,2-Bis-(2-chlorethylthio)-ethan

(3563-36-8)

Bis- 1,3-(2-chlorethylthio)-n-propan

(63905-10-2)

Bis- 1,4-(2-chlorethylthio)-n-butan

(142868-93-7)

Bis- 1,5-(2-chlorethylthio)-n-pentan

(142868-94-8)

Bis-(2-chlorethylthiomethyl)-ether

(63918-90-1)

O-Lost: Bis-(2-chlorethylthioethyl)-ether

(63918-89-8)

5.

Lewisite:

 

Lewisit 1: 2-Chlorvinyldichlorarsin

(541-25-3)

Lewisit 2: Bis-(2-chlorvinyl)-chlorarsin

(40334-69-8)

Lewisit 3: Tris-(2-chlorvinyl)-arsin

(40334-70-1)

6.

Stickstoffloste:

 

HN1: Bis-(2-chlorethyl)-ethylamin

(538-07-8)

HN2: Bis-(2-chlorethyl)-methylamin

(51-75-2)

HN3: Tris-(2-chlorethyl)-amin

(555-77-1)

7.

Saxitoxin

(35523-89-8)

8.

Ricin

(9009-86-3)

B. Ausgangsstoffe:

 

9.

Alkyl (Me, Et, n-Pr oder i-Pr)-phosphonsäuredifluoride

 

zB DF: Methylphosphonsäuredifluorid              

(676-99-3)

10.

O-Alkyl (H oder C10 einschließlich Cycloalkyl)-O-2-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethyl-alkyl (Me, Et, n-Pr oder i-Pr)-phosphonite und entsprechende alkylierte und protonierte Salze

 

zB QL: O-Ethyl-O-2-diisopropylaminoethyl-methylphosphonit

(57856-11-8)

11.

Chlor-Sarin: O-Isopropylmethylphosphonochlorid

(1445-76-7)

12.

Chlor-Soman: O-Pinakolylmethylphosphonochlorid

(7040-57-5)

Liste 2

A. Toxische Chemikalien:

1.

Amiton: 0,0-Diethyl-S-[2-(diethylamino)-ethyl]-phosphorthiolat und entsprechende alkylierte und protonierte Salze

(78-53-5)

2.

PFIB: 1,1,3,3,3-Pentafluor-2-(trifluormethyl)-1-propen

(382-21-8)

3.

BZ: 3-Chinuclidinylbenzilat

(6581-06-2)

B. Ausgangsstoffe:

 

4.

Chemikalien, mit Ausnahme der in Liste 1 genannten, die ein Phosphor- atom enthalten, an das eine und nur eine unsubstituierte Methyl-, Ethyl- oder Propyl-(Normal- oder Iso-)Gruppe gebunden ist, jedoch keine weiteren Kohlenstoffatome

 

zB Methylphosphonsäuredichlorid

(676-97-1)

Dimethylmethylphosphonat

(765-79-6)

Ausnahme: Fonofos: O-Ethyl-S-phenyl-ethyldithiophosphonat

(944-22-9)

5.

N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-phosphoramid-dihalogenide

 

6.

Dialkyl (Me, Et, n-Pr oder i-Pr)-N,N-dialkyl (Me, Et, n-Pr oder i-Pr)- phosphoramidate

 

7.

Arsentrichlorid

(7784-34-1)

8.2,2-Diphenyl-2-hydroxyessigsäure

(76-93-7)

9.

Chinuclidin-3-ol

(1619-34-7)

10.

N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-2-chloride und entsprechende protonierte Salze

 

11.

N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-2-ol und entsprechende protonierte Salze

 

Ausnahmen: N,N-Dimethylaminoethanol und entsprechende protonierte Salze

(108-01-0)

 N,N-Diethylaminoethanol und entsprechende protonierte Salze

(100-37-8)

12.

N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-2-thiol und entsprechende protonierte Salze

 

13.

Thiodiglykol: Bis-(2-hydroxyethyl)-sulfid

(111-48-8)

14.

Pinakolylalkohol: 3,3-Dimethylbutan-2-ol

(464-07-3)

Liste 3

A. Toxische Chemikalien:

 

1.

Phosgen: Carbonyldichlorid

(75-44-5)

2.

Chlorcyan

(506-77-4)

3.

Cyanwasserstoff

(74-90-8)

4.

Chlorpikrin: Trichlornitromethan

(76-06-2)

B. Ausgangsstoffe:

 

5.

Phosphoroxidchlorid

(10025-87-3)

6.

Phosphortrichlorid

(7719-12-2)

7.

Phosphorpentachlorid

(10026-13-8)

8.

Trimethylphosphit

(121-45-9)

9.

Triethylphosphit

(122-52-1)

10.

Dimethylphosphit

(868-85-9)

11.

Diethylphosphit

(762-04-9)

12.

Schwefelmonochlorid

(10025-67-9)

13.

Schwefeldichlorid

(10545-99-0)

14.

Thionylchlorid

(7719-09-7)

15.

Ethyldiethanolamin

(139-87-7)

16.

Methyldiethanolamin

(105-59-9)

17.

Triethanolamin

(102-71-6)

 

Zuletzt aktualisiert am

16.11.2011

Gesetzesnummer

20004127

Dokumentnummer

NOR40065225