Bundesrecht konsolidiert

Chemiewaffenkonvention-Durchführungsgesetz Anl. 1

Diese Fassung ist nicht aktuell

Kurztitel

Chemiewaffenkonvention-Durchführungsgesetz

Kundmachungsorgan

BGBl. I Nr. 24/1997 aufgehoben durch BGBl. I Nr. 50/2005

Typ

BG

§/Artikel/Anlage

Anl. 1

Inkrafttretensdatum

29.04.1997

Außerkrafttretensdatum

30.09.2005

Abkürzung

CWKG

Index

41/04 Sprengmittel, Waffen, Munition

Text

Anhang

 

CHEMIKALIENLISTEN

 

In den folgenden Listen sind toxische Chemikalien und Vorprodukte und für die Anwendung der CWK kritische Chemikalien genannt. Zum Zweck der Durchführung dieses Übereinkommens sind in den Listen die Chemikalien angegeben, auf welche die im Verifikationsanhang der CWK vorgesehenen Verifikationsmaßnahmen anzuwenden sind.

  (Jeder Hinweis auf Gruppen dialkylierter Chemikalien denen - in

Klammern - eine Aufzählung von Alkylgruppen folgt, bedeutet, daß alle

Verbindungen die sich durch sämtliche möglichen Kombinationen der in

Klammern genannten Alkylgruppen ergeben, als in die entsprechende

Liste eingetragen gelten, sofern sie nicht ausdrücklich ausgenommen

sind.)

                                              Registriernummer nach

                                          Chemical Abstracts Service

                                                 (CAS-Nummer)

 

Liste 1

 

A. Toxische Chemikalien:

   1. O-Alkyl (C hoch 10, einschließlich

      Cycloalkyl)-alkyl-(Me, Et, n-Pr oder

      i-Pr)phosphonofluoride

      zB Sarin: O-Isopropylmethylphosphonofluorid          (107-44-8)

         Soman: O-Pinakolylmethylphosphonofluorid           (96-64-0)

   2. O-Alkyl (C10 einschließlich Cycloalkyl)-

      N,N-dialkyl (Me, Et, n-Pr oder

      i-Pr)-phosphoramidocyanide

      zB Tabun: O-Ethyl-N,N-dimethylphosphoramidocyanid     (77-81-6)

   3. O-Alkyl (H oder C10 einschließlich Cycloalkyl)-

      S-2-dialkyl (Me, Et, n-Pr oder i-Pr)-

      aminoethylalkyl

      (Me, Et, n-Pr oder i-Pr)-phosphonothiolate sowie

      entsprechende alkylierte und protonierte Salze

      zB VX: O-Ethyl-S-2-diisopropylaminoethylmethyl-

      phosphonothiolat                                   (50782-69-9)

   4. Schwefelloste:

      2-Chlorethylchlormethylsulfid                       (2625-76-5)

      Senfgas: Bis- (2-chlorethyl)-sulfid                  (505-60-2)

      Bis-(2-chlorethylthio)-methan                      (63869-13-6)

      Sesqui-Yperit (Q): 1 ,2-Bis-(2-chlorethylthio)-

      ethan                                               (3563-36-8)

      Bis- 1,3-(2-chlorethylthio)-n-propan               (63905-10-2)

      Bis- 1,4-(2-chlorethylthio)-n-butan               (142868-93-7)

      Bis- 1,5-(2-chlorethylthio)-n-pentan              (142868-94-8)

      Bis-(2-chlorethylthiomethyl)-ether                 (63918-90-1)

      O-Lost: Bis-(2-chlorethylthioethyl)-ether          (63918-89-8)

   5. Lewisite:

      Lewisit 1: 2-Chlorvinyldichlorarsin                  (541-25-3)

      Lewisit 2: Bis-(2-chlorvinyl)-chlorarsin           (40334-69-8)

      Lewisit 3: Tris-(2-chlorvinyl)-arsin               (40334-70-1)

   6. Stickstoffloste:

      HN1: Bis-(2-chlorethyl)-ethylamin                    (538-07-8)

      HN2: Bis-(2-chlorethyl)-methylamin                    (51-75-2)

      HN3: Tris-(2-chlorethyl)-amin                        (555-77-1)

   7. Saxitoxin                                          (35523-89-8)

   8. Ricin                                               (9009-86-3)

 

B. Ausgangsstoffe:

   9. Alkyl (Me, Et, n-Pr oder i-Pr)-

      phosphonsäuredifluoride

      zB DF: Methylphosphonsäuredifluorid                  (676-99-3)

  10. O-Alkyl (H oder C10 einschließlich Cycloalkyl)-

      O-2-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethyl-

      alkyl (Me, Et, n-Pr oder i-Pr)-phosphonite und

      entsprechende alkylierte und protonierte Salze

      zB QL: O-Ethyl-O-2-diisopropylaminoethyl-

      methylphosphonit                                   (57856-11-8)

  11. Chlor-Sarin: O-Isopropylmethylphosphonochlorid      (1445-76-7)

  12. Chlor-Soman: O-Pinakolylmethylphosphonochlorid      (7040-57-5)

 

Liste 2

 

A. Toxische Chemikalien:

   1. Amiton: 0,0-Diethyl-S-(2-(diethylamino)-ethyl)-

      phosphorthiolat und entsprechende alkylierte und

      protonierte Salze                                     (78-53-5)

   2. PFIB: 1,1,3,3,3-Pentafluor-2-(trifluormethyl)-1-

      propen                                               (382-21-8)

   3. BZ: 3-Chinuclidinylbenzilat                         (6581-06-2)

 

B. Ausgangsstoffe:

   4. Chemikalien, mit Ausnahme der in Liste 1

      genannten, die ein Phosphoratom enthalten, an das

      eine und nur eine unsubstituierte Methyl-, Ethyl-

      oder Propyl-(Normal- oder Iso-)Gruppe gebunden

      ist, jedoch keine weiteren Kohlenstoffatome

      zB Methylphosphonsäuredichlorid                      (676-97-1)

         Dimethylmethylphosphonat                          (765-79-6)

         Ausnahme: Fonofos: O-Ethyl-S-phenyl-

                   ethyldithiophosphonat                   (944-22-9)

   5. N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-phosphoramid-

      dihalogenide

   6. Dialkyl (Me, Et, n-Pr oder i-Pr)-N,N-dialkyl (Me,

      Et, n-Pr oder i-Pr)-phosphoramidate

   7. Arsentrichlorid                                     (7784-34-1)

   8. 2,2-Diphenyl-2-hydroxyessigsäure                      (76-93-7)

   9. Chinuclidin-3-ol                                    (1619-34-7)

  10. N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-

      2-chloride und entsprechende protonierte Salze

  11. N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-

      2-ol und entsprechende protonierte Salze

      Ausnahmen: N,N-Dimethylaminoethanol und

                 entsprechende protonierte Salze           (108-01-0)

                 N,N-Diethylaminoethanol und

                 entsprechende protonierte Salze           (100-37-8)

  12. N,N-Dialkyl (Me, Et, n-Pr oder i-Pr)-aminoethan-

      2-thiol und entsprechende protonierte Salze

  13. Thiodiglykol: Bis-(2-hydroxyethyl)-sulfid            (111-48-8)

  14. Pinakolylalkohol: 3,3-Dimethylbutan-2-ol             (464-07-3)

 

Liste 3

 

A. Toxische Chemikalien:

   1. Phosgen: Carbonyldichlorid                            (75-44-5)

   2. Chlorcyan                                            (506-77-4)

   3. Cyanwasserstoff                                       (74-90-8)

   4. Chlorpikrin: Trichlornitromethan                      (76-06-2)

 

B. Ausgangsstoffe:

   5. Phosphoroxidchlorid                                (10025-87-3)

   6. Phosphortrichlorid                                  (7719-12-2)

   7. Phosphorpentachlorid                               (10026-13-8)

   8. Trimethylphosphit                                    (121-45-9)

   9. Triethylphosphit                                     (122-52-1)

  10. Dimethylphosphit                                     (868-85-9)

  11. Diethylphosphit                                      (762-04-9)

  12. Schwefelmonochlorid                                (10025-67-9)

  13. Schwefeldichlorid                                  (10545-99-0)

  14. Thionylchlorid                                      (7719-09-7)

  15. Ethyldiethanolamin                                   (139-87-7)

  16. Methyldiethanolamin                                  (105-59-9)

  17. Triethanolamin                                       (102-71-6)

Anmerkung

Formeln nicht direkt darstellbar

Gesetzesnummer

10006031

Dokumentnummer

NOR12066221

Alte Dokumentnummer

N4199761174J